C15H16O4S — CID 82533975
2-[4-(1-oxo-1-prop-2-ynoxybutan-2-yl)sulfanylphenyl]acetic acid (PubChem CID 82533975) has the molecular formula C15H16O4S and a molecular weight of 292.36 g/mol. Its IUPAC name is 2-[4-(1-oxo-1-prop-2-ynoxybutan-2-yl)sulfanylphenyl]acetic acid.
| Compound Name | 2-[4-(1-oxo-1-prop-2-ynoxybutan-2-yl)sulfanylphenyl]acetic acid |
|---|---|
| PubChem CID | 82533975 |
| Molecular Formula | C15H16O4S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 2-[4-(1-oxo-1-prop-2-ynoxybutan-2-yl)sulfanylphenyl]acetic acid |
| SMILES | C#CCOC(=O)C(CC)Sc1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C15H16O4S/c1-3-9-19-15(18)13(4-2)20-12-7-5-11(6-8-12)10-14(16)17/h1,5-8,13H,4,9-10H2,2H3,(H,16,17) |
| InChIKey | VSRHDFATWTWGHH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|