C11H12Cl2F3N — CID 82534769
3-[(2,3-dichlorophenyl)methyl]-4,4,4-trifluorobutan-1-amine (PubChem CID 82534769) has the molecular formula C11H12Cl2F3N and a molecular weight of 286.12 g/mol. Its IUPAC name is 3-[(2,3-dichlorophenyl)methyl]-4,4,4-trifluorobutan-1-amine.
| Compound Name | 3-[(2,3-dichlorophenyl)methyl]-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 82534769 |
| Molecular Formula | C11H12Cl2F3N |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 3-[(2,3-dichlorophenyl)methyl]-4,4,4-trifluorobutan-1-amine |
| SMILES | NCCC(Cc1cccc(Cl)c1Cl)C(F)(F)F |
| InChI | InChI=1S/C11H12Cl2F3N/c12-9-3-1-2-7(10(9)13)6-8(4-5-17)11(14,15)16/h1-3,8H,4-6,17H2 |
| InChIKey | KPLDUMSTBVXOMX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |