C17H14F2O2 — CID 82543948
(E)-4-[4-(3,4-difluorophenyl)phenyl]-3-methylbut-2-enoic acid (PubChem CID 82543948) has the molecular formula C17H14F2O2 and a molecular weight of 288.29 g/mol. Its IUPAC name is (E)-4-[4-(3,4-difluorophenyl)phenyl]-3-methylbut-2-enoic acid.
| Compound Name | (E)-4-[4-(3,4-difluorophenyl)phenyl]-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 82543948 |
| Molecular Formula | C17H14F2O2 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (E)-4-[4-(3,4-difluorophenyl)phenyl]-3-methylbut-2-enoic acid |
| SMILES | C/C(=C\C(=O)O)Cc1ccc(-c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H14F2O2/c1-11(9-17(20)21)8-12-2-4-13(5-3-12)14-6-7-15(18)16(19)10-14/h2-7,9-10H,8H2,1H3,(H,20,21)/b11-9+ |
| InChIKey | XSCSYNUSEDODTF-PKNBQFBNSA-N |
| XLogP | 4.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|