C17H20N2O3 — CID 82544563
2-[1-(aminomethyl)-5,7-dimethoxy-1,3-dihydroisoindol-2-yl]phenol (PubChem CID 82544563) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-[1-(aminomethyl)-5,7-dimethoxy-1,3-dihydroisoindol-2-yl]phenol.
| Compound Name | 2-[1-(aminomethyl)-5,7-dimethoxy-1,3-dihydroisoindol-2-yl]phenol |
|---|---|
| PubChem CID | 82544563 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-[1-(aminomethyl)-5,7-dimethoxy-1,3-dihydroisoindol-2-yl]phenol |
| SMILES | COc1cc2c(c(OC)c1)C(CN)N(c1ccccc1O)C2 |
| InChI | InChI=1S/C17H20N2O3/c1-21-12-7-11-10-19(13-5-3-4-6-15(13)20)14(9-18)17(11)16(8-12)22-2/h3-8,14,20H,9-10,18H2,1-2H3 |
| InChIKey | SPYJJXVQBUQVTE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |