C16H23FN2 — CID 82545619
(2-cycloheptyl-4-fluoro-1,3-dihydroisoindol-1-yl)methanamine (PubChem CID 82545619) has the molecular formula C16H23FN2 and a molecular weight of 262.37 g/mol. Its IUPAC name is (2-cycloheptyl-4-fluoro-1,3-dihydroisoindol-1-yl)methanamine.
| Compound Name | (2-cycloheptyl-4-fluoro-1,3-dihydroisoindol-1-yl)methanamine |
|---|---|
| PubChem CID | 82545619 |
| Molecular Formula | C16H23FN2 |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (2-cycloheptyl-4-fluoro-1,3-dihydroisoindol-1-yl)methanamine |
| SMILES | NCC1c2cccc(F)c2CN1C1CCCCCC1 |
| InChI | InChI=1S/C16H23FN2/c17-15-9-5-8-13-14(15)11-19(16(13)10-18)12-6-3-1-2-4-7-12/h5,8-9,12,16H,1-4,6-7,10-11,18H2 |
| InChIKey | HOTRDJHZMYRQGP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |