C17H24ClNO3 — CID 82551487
[2-chloro-4,5-di(propan-2-yloxy)phenyl]-pyrrolidin-2-ylmethanone (PubChem CID 82551487) has the molecular formula C17H24ClNO3 and a molecular weight of 325.84 g/mol. Its IUPAC name is [2-chloro-4,5-di(propan-2-yloxy)phenyl]-pyrrolidin-2-ylmethanone.
| Compound Name | [2-chloro-4,5-di(propan-2-yloxy)phenyl]-pyrrolidin-2-ylmethanone |
|---|---|
| PubChem CID | 82551487 |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | [2-chloro-4,5-di(propan-2-yloxy)phenyl]-pyrrolidin-2-ylmethanone |
| SMILES | CC(C)Oc1cc(Cl)c(C(=O)C2CCCN2)cc1OC(C)C |
| InChI | InChI=1S/C17H24ClNO3/c1-10(2)21-15-8-12(17(20)14-6-5-7-19-14)13(18)9-16(15)22-11(3)4/h8-11,14,19H,5-7H2,1-4H3 |
| InChIKey | RWSZVEXFJQCMHL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |