C16H20Cl2O2 — CID 82553847
cyclohexyl-(4,5-dichloro-2-propan-2-yloxyphenyl)methanone (PubChem CID 82553847) has the molecular formula C16H20Cl2O2 and a molecular weight of 315.24 g/mol. Its IUPAC name is cyclohexyl-(4,5-dichloro-2-propan-2-yloxyphenyl)methanone.
| Compound Name | cyclohexyl-(4,5-dichloro-2-propan-2-yloxyphenyl)methanone |
|---|---|
| PubChem CID | 82553847 |
| Molecular Formula | C16H20Cl2O2 |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | cyclohexyl-(4,5-dichloro-2-propan-2-yloxyphenyl)methanone |
| SMILES | CC(C)Oc1cc(Cl)c(Cl)cc1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C16H20Cl2O2/c1-10(2)20-15-9-14(18)13(17)8-12(15)16(19)11-6-4-3-5-7-11/h8-11H,3-7H2,1-2H3 |
| InChIKey | NYHZURIJMQJUCK-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |