C13H16O4 — CID 82552654
ethyl 2-(4-hydroxy-2,3,6-trimethylphenyl)-2-oxoacetate (PubChem CID 82552654) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is ethyl 2-(4-hydroxy-2,3,6-trimethylphenyl)-2-oxoacetate.
| Compound Name | ethyl 2-(4-hydroxy-2,3,6-trimethylphenyl)-2-oxoacetate |
|---|---|
| PubChem CID | 82552654 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | ethyl 2-(4-hydroxy-2,3,6-trimethylphenyl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1c(C)cc(O)c(C)c1C |
| InChI | InChI=1S/C13H16O4/c1-5-17-13(16)12(15)11-7(2)6-10(14)8(3)9(11)4/h6,14H,5H2,1-4H3 |
| InChIKey | CMJYQNGAQJENNR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|