C13H15ClO4 — CID 117108928
ethyl 2-(3-chloro-4-hydroxy-2,5,6-trimethylphenyl)-2-oxoacetate (PubChem CID 117108928) has the molecular formula C13H15ClO4 and a molecular weight of 270.71 g/mol. Its IUPAC name is ethyl 2-(3-chloro-4-hydroxy-2,5,6-trimethylphenyl)-2-oxoacetate.
| Compound Name | ethyl 2-(3-chloro-4-hydroxy-2,5,6-trimethylphenyl)-2-oxoacetate |
|---|---|
| PubChem CID | 117108928 |
| Molecular Formula | C13H15ClO4 |
| Molecular Weight | 270.71 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | ethyl 2-(3-chloro-4-hydroxy-2,5,6-trimethylphenyl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1c(C)c(C)c(O)c(Cl)c1C |
| InChI | InChI=1S/C13H15ClO4/c1-5-18-13(17)12(16)9-6(2)7(3)11(15)10(14)8(9)4/h15H,5H2,1-4H3 |
| InChIKey | VRPJUEGKJLBQHK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.71 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|