C10H5BrClF3O3 — CID 117108982
ethyl 2-(2-bromo-4-chloro-3,5,6-trifluorophenyl)-2-oxoacetate (PubChem CID 117108982) has the molecular formula C10H5BrClF3O3 and a molecular weight of 345.50 g/mol. Its IUPAC name is ethyl 2-(2-bromo-4-chloro-3,5,6-trifluorophenyl)-2-oxoacetate.
| Compound Name | ethyl 2-(2-bromo-4-chloro-3,5,6-trifluorophenyl)-2-oxoacetate |
|---|---|
| PubChem CID | 117108982 |
| Molecular Formula | C10H5BrClF3O3 |
| Molecular Weight | 345.50 g/mol |
| Exact Mass | 343.91 |
| IUPAC Name | ethyl 2-(2-bromo-4-chloro-3,5,6-trifluorophenyl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1c(F)c(F)c(Cl)c(F)c1Br |
| InChI | InChI=1S/C10H5BrClF3O3/c1-2-18-10(17)9(16)3-4(11)7(14)5(12)8(15)6(3)13/h2H2,1H3 |
| InChIKey | ZZRWFOOKTGERLW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|