C12H13BrO4 — CID 117484703
ethyl 2-(3-bromo-2-hydroxy-4,6-dimethylphenyl)-2-oxoacetate (PubChem CID 117484703) has the molecular formula C12H13BrO4 and a molecular weight of 301.14 g/mol. Its IUPAC name is ethyl 2-(3-bromo-2-hydroxy-4,6-dimethylphenyl)-2-oxoacetate.
| Compound Name | ethyl 2-(3-bromo-2-hydroxy-4,6-dimethylphenyl)-2-oxoacetate |
|---|---|
| PubChem CID | 117484703 |
| Molecular Formula | C12H13BrO4 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | ethyl 2-(3-bromo-2-hydroxy-4,6-dimethylphenyl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1c(C)cc(C)c(Br)c1O |
| InChI | InChI=1S/C12H13BrO4/c1-4-17-12(16)11(15)8-6(2)5-7(3)9(13)10(8)14/h5,14H,4H2,1-3H3 |
| InChIKey | SXBWNNXAWROVRU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|