C17H13N3O4 — CID 82554445
3-[(3,5-dioxo-6-phenyl-1,2,4-triazin-2-yl)methyl]benzoic acid (PubChem CID 82554445) has the molecular formula C17H13N3O4 and a molecular weight of 323.31 g/mol. Its IUPAC name is 3-[(3,5-dioxo-6-phenyl-1,2,4-triazin-2-yl)methyl]benzoic acid.
| Compound Name | 3-[(3,5-dioxo-6-phenyl-1,2,4-triazin-2-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 82554445 |
| Molecular Formula | C17H13N3O4 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 3-[(3,5-dioxo-6-phenyl-1,2,4-triazin-2-yl)methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(Cn2nc(-c3ccccc3)c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C17H13N3O4/c21-15-14(12-6-2-1-3-7-12)19-20(17(24)18-15)10-11-5-4-8-13(9-11)16(22)23/h1-9H,10H2,(H,22,23)(H,18,21,24) |
| InChIKey | OEZHKHAJTHXXLH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |