C13H16N4 — CID 82556987
8-(3-methylphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 82556987) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is 8-(3-methylphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-(3-methylphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 82556987 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 8-(3-methylphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1cccc(C2CCCn3nc(N)nc32)c1 |
| InChI | InChI=1S/C13H16N4/c1-9-4-2-5-10(8-9)11-6-3-7-17-12(11)15-13(14)16-17/h2,4-5,8,11H,3,6-7H2,1H3,(H2,14,16) |
| InChIKey | UWURXSHOMADLRC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |