C14H17FN4O — CID 82557277
6-(5-fluoro-2-methoxyphenyl)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 82557277) has the molecular formula C14H17FN4O and a molecular weight of 276.31 g/mol. Its IUPAC name is 6-(5-fluoro-2-methoxyphenyl)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 6-(5-fluoro-2-methoxyphenyl)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 82557277 |
| Molecular Formula | C14H17FN4O |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 6-(5-fluoro-2-methoxyphenyl)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | COc1ccc(F)cc1C1CC(C)c2nc(N)nn2C1 |
| InChI | InChI=1S/C14H17FN4O/c1-8-5-9(7-19-13(8)17-14(16)18-19)11-6-10(15)3-4-12(11)20-2/h3-4,6,8-9H,5,7H2,1-2H3,(H2,16,18) |
| InChIKey | ZHYKGSQXWKDJHZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |