C15H15N5S — CID 82558265
3-[[2-(1,3-thiazol-2-ylmethyl)imidazol-1-yl]methyl]benzenecarboximidamide (PubChem CID 82558265) has the molecular formula C15H15N5S and a molecular weight of 297.39 g/mol. Its IUPAC name is 3-[[2-(1,3-thiazol-2-ylmethyl)imidazol-1-yl]methyl]benzenecarboximidamide.
| Compound Name | 3-[[2-(1,3-thiazol-2-ylmethyl)imidazol-1-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 82558265 |
| Molecular Formula | C15H15N5S |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-[[2-(1,3-thiazol-2-ylmethyl)imidazol-1-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(Cn2ccnc2Cc2nccs2)c1 |
| InChI | InChI=1S/C15H15N5S/c16-15(17)12-3-1-2-11(8-12)10-20-6-4-18-13(20)9-14-19-5-7-21-14/h1-8H,9-10H2,(H3,16,17) |
| InChIKey | RZVWUMOGSDCGMF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|