C14H9ClN6O2 — CID 82563704
6-chloro-N-(4-nitrophenyl)-1H-[1,2,4]triazolo[1,5-a]benzimidazol-2-amine (PubChem CID 82563704) has the molecular formula C14H9ClN6O2 and a molecular weight of 328.72 g/mol. Its IUPAC name is 6-chloro-N-(4-nitrophenyl)-1H-[1,2,4]triazolo[1,5-a]benzimidazol-2-amine.
| Compound Name | 6-chloro-N-(4-nitrophenyl)-1H-[1,2,4]triazolo[1,5-a]benzimidazol-2-amine |
|---|---|
| PubChem CID | 82563704 |
| Molecular Formula | C14H9ClN6O2 |
| Molecular Weight | 328.72 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 6-chloro-N-(4-nitrophenyl)-1H-[1,2,4]triazolo[1,5-a]benzimidazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc(Nc2nc3nc4cc(Cl)ccc4n3[nH]2)cc1 |
| InChI | InChI=1S/C14H9ClN6O2/c15-8-1-6-12-11(7-8)17-14-18-13(19-20(12)14)16-9-2-4-10(5-3-9)21(22)23/h1-7H,(H2,16,17,18,19) |
| InChIKey | XWUZEPUJZBXJOM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.72 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|