C15H10N6O4 — CID 82563964
2-(4-nitroanilino)-1H-[1,2,4]triazolo[1,5-a]benzimidazole-6-carboxylic acid (PubChem CID 82563964) has the molecular formula C15H10N6O4 and a molecular weight of 338.28 g/mol. Its IUPAC name is 2-(4-nitroanilino)-1H-[1,2,4]triazolo[1,5-a]benzimidazole-6-carboxylic acid.
| Compound Name | 2-(4-nitroanilino)-1H-[1,2,4]triazolo[1,5-a]benzimidazole-6-carboxylic acid |
|---|---|
| PubChem CID | 82563964 |
| Molecular Formula | C15H10N6O4 |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 2-(4-nitroanilino)-1H-[1,2,4]triazolo[1,5-a]benzimidazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc1nc(Nc3ccc([N+](=O)[O-])cc3)[nH]n12 |
| InChI | InChI=1S/C15H10N6O4/c22-13(23)8-1-6-12-11(7-8)17-15-18-14(19-20(12)15)16-9-2-4-10(5-3-9)21(24)25/h1-7H,(H,22,23)(H2,16,17,18,19) |
| InChIKey | SFTKMJZIXAHVBT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|