C17H17N3 — CID 82572283
1-N,1-N-dimethyl-4-N-phenylisoquinoline-1,4-diamine (PubChem CID 82572283) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-N,1-N-dimethyl-4-N-phenylisoquinoline-1,4-diamine.
| Compound Name | 1-N,1-N-dimethyl-4-N-phenylisoquinoline-1,4-diamine |
|---|---|
| PubChem CID | 82572283 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 1-N,1-N-dimethyl-4-N-phenylisoquinoline-1,4-diamine |
| SMILES | CN(C)c1ncc(Nc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C17H17N3/c1-20(2)17-15-11-7-6-10-14(15)16(12-18-17)19-13-8-4-3-5-9-13/h3-12,19H,1-2H3 |
| InChIKey | WYTVKURGUXVFAO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |