C14H14ClNO2 — CID 82578034
3-(4-chloro-2,8-dimethylquinolin-6-yl)propanoic acid (PubChem CID 82578034) has the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. Its IUPAC name is 3-(4-chloro-2,8-dimethylquinolin-6-yl)propanoic acid.
| Compound Name | 3-(4-chloro-2,8-dimethylquinolin-6-yl)propanoic acid |
|---|---|
| PubChem CID | 82578034 |
| Molecular Formula | C14H14ClNO2 |
| Molecular Weight | 263.72 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 3-(4-chloro-2,8-dimethylquinolin-6-yl)propanoic acid |
| SMILES | Cc1cc(Cl)c2cc(CCC(=O)O)cc(C)c2n1 |
| InChI | InChI=1S/C14H14ClNO2/c1-8-5-10(3-4-13(17)18)7-11-12(15)6-9(2)16-14(8)11/h5-7H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | VYYANYCBBIOXQP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.72 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |