About 2,4-dichloro-7,8-dimethylquinoline
2,4-dichloro-7,8-dimethylquinoline (PubChem CID 82581103) has the molecular formula C11H9Cl2N
and a molecular weight of 226.11 g/mol. Its IUPAC name is 2,4-dichloro-7,8-dimethylquinoline.
Molecular Properties
| Compound Name | 2,4-dichloro-7,8-dimethylquinoline |
| PubChem CID | 82581103 |
| Molecular Formula | C11H9Cl2N |
| Molecular Weight | 226.11 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 2,4-dichloro-7,8-dimethylquinoline |
| SMILES | Cc1ccc2c(Cl)cc(Cl)nc2c1C |
| InChI | InChI=1S/C11H9Cl2N/c1-6-3-4-8-9(12)5-10(13)14-11(8)7(6)2/h3-5H,1-2H3 |
| InChIKey | DAJFTBJUGYQXCX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.11 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichloro-7,8-dimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-7,8-dimethylquinoline?
The IUPAC name of 2,4-dichloro-7,8-dimethylquinoline (CID 82581103) is 2,4-dichloro-7,8-dimethylquinoline.
What is the SMILES notation for 2,4-dichloro-7,8-dimethylquinoline?
The canonical SMILES for 2,4-dichloro-7,8-dimethylquinoline is Cc1ccc2c(Cl)cc(Cl)nc2c1C.
What is the InChIKey of 2,4-dichloro-7,8-dimethylquinoline?
The InChIKey is DAJFTBJUGYQXCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl2N/c1-6-3-4-8-9(12)5-10(13)14-11(8)7(6)2/h3-5H,1-2H3.
What are the key properties of 2,4-dichloro-7,8-dimethylquinoline?
2,4-dichloro-7,8-dimethylquinoline has a molecular weight of 226.11 g/mol, XLogP of 4.16, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-7,8-dimethylquinoline is sourced from PubChem (CID 82581103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).