About methyl 2-(6,7-dimethyl-5H-imidazo[1,2-b]pyrazol-2-yl)acetate
methyl 2-(6,7-dimethyl-5H-imidazo[1,2-b]pyrazol-2-yl)acetate (PubChem CID 82590162) has the molecular formula C10H13N3O2
and a molecular weight of 207.23 g/mol. Its IUPAC name is methyl 2-(6,7-dimethyl-5H-imidazo[1,2-b]pyrazol-2-yl)acetate.
Analyze methyl 2-(6,7-dimethyl-5H-imidazo[1,2-b]pyrazol-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(6,7-dimethyl-5H-imidazo[1,2-b]pyrazol-2-yl)acetate?
The IUPAC name of methyl 2-(6,7-dimethyl-5H-imidazo[1,2-b]pyrazol-2-yl)acetate (CID 82590162) is methyl 2-(6,7-dimethyl-5H-imidazo[1,2-b]pyrazol-2-yl)acetate.
What is the SMILES notation for methyl 2-(6,7-dimethyl-5H-imidazo[1,2-b]pyrazol-2-yl)acetate?
The canonical SMILES for methyl 2-(6,7-dimethyl-5H-imidazo[1,2-b]pyrazol-2-yl)acetate is COC(=O)Cc1cn2[nH]c(C)c(C)c2n1.
What is the InChIKey of methyl 2-(6,7-dimethyl-5H-imidazo[1,2-b]pyrazol-2-yl)acetate?
The InChIKey is PGHLDGBJXDEWFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O2/c1-6-7(2)12-13-5-8(11-10(6)13)4-9(14)15-3/h5,12H,4H2,1-3H3.
What are the key properties of methyl 2-(6,7-dimethyl-5H-imidazo[1,2-b]pyrazol-2-yl)acetate?
methyl 2-(6,7-dimethyl-5H-imidazo[1,2-b]pyrazol-2-yl)acetate has a molecular weight of 207.23 g/mol, XLogP of 0.99, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(6,7-dimethyl-5H-imidazo[1,2-b]pyrazol-2-yl)acetate is sourced from PubChem (CID 82590162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).