C7H7N3O2S2 — CID 139652057
methyl 2-(2-sulfanylidene-3H-imidazo[2,1-b][1,3,4]thiadiazol-6-yl)acetate (PubChem CID 139652057) has the molecular formula C7H7N3O2S2 and a molecular weight of 229.29 g/mol. Its IUPAC name is methyl 2-(2-sulfanylidene-3H-imidazo[2,1-b][1,3,4]thiadiazol-6-yl)acetate.
| Compound Name | methyl 2-(2-sulfanylidene-3H-imidazo[2,1-b][1,3,4]thiadiazol-6-yl)acetate |
|---|---|
| PubChem CID | 139652057 |
| Molecular Formula | C7H7N3O2S2 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | methyl 2-(2-sulfanylidene-3H-imidazo[2,1-b][1,3,4]thiadiazol-6-yl)acetate |
| SMILES | COC(=O)Cc1cn2[nH]c(=S)sc2n1 |
| InChI | InChI=1S/C7H7N3O2S2/c1-12-5(11)2-4-3-10-6(8-4)14-7(13)9-10/h3H,2H2,1H3,(H,9,13) |
| InChIKey | HQLDEEXCBYJGEV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|