C15H16N2O2 — CID 82590474
1-methyl-3-(phenoxymethyl)-6,7-dihydro-5H-indazol-4-one (PubChem CID 82590474) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 1-methyl-3-(phenoxymethyl)-6,7-dihydro-5H-indazol-4-one.
| Compound Name | 1-methyl-3-(phenoxymethyl)-6,7-dihydro-5H-indazol-4-one |
|---|---|
| PubChem CID | 82590474 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1-methyl-3-(phenoxymethyl)-6,7-dihydro-5H-indazol-4-one |
| SMILES | Cn1nc(COc2ccccc2)c2c1CCCC2=O |
| InChI | InChI=1S/C15H16N2O2/c1-17-13-8-5-9-14(18)15(13)12(16-17)10-19-11-6-3-2-4-7-11/h2-4,6-7H,5,8-10H2,1H3 |
| InChIKey | FVISWVXRAKKWQQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |