C17H20N2O — CID 82590685
3-ethyl-1-(1-phenylethyl)-6,7-dihydro-5H-indazol-4-one (PubChem CID 82590685) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-ethyl-1-(1-phenylethyl)-6,7-dihydro-5H-indazol-4-one.
| Compound Name | 3-ethyl-1-(1-phenylethyl)-6,7-dihydro-5H-indazol-4-one |
|---|---|
| PubChem CID | 82590685 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 3-ethyl-1-(1-phenylethyl)-6,7-dihydro-5H-indazol-4-one |
| SMILES | CCc1nn(C(C)c2ccccc2)c2c1C(=O)CCC2 |
| InChI | InChI=1S/C17H20N2O/c1-3-14-17-15(10-7-11-16(17)20)19(18-14)12(2)13-8-5-4-6-9-13/h4-6,8-9,12H,3,7,10-11H2,1-2H3 |
| InChIKey | ACIHNKVJGIJXAQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |