C9H17N3 — CID 82597545
3-(2,3-dimethylimidazol-4-yl)butan-1-amine (PubChem CID 82597545) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 3-(2,3-dimethylimidazol-4-yl)butan-1-amine.
| Compound Name | 3-(2,3-dimethylimidazol-4-yl)butan-1-amine |
|---|---|
| PubChem CID | 82597545 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 3-(2,3-dimethylimidazol-4-yl)butan-1-amine |
| SMILES | Cc1ncc(C(C)CCN)n1C |
| InChI | InChI=1S/C9H17N3/c1-7(4-5-10)9-6-11-8(2)12(9)3/h6-7H,4-5,10H2,1-3H3 |
| InChIKey | MLMQZZRVYMGWOZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |