3-(2,3-dimethylimidazol-4-yl)-2-methylpropanoic acid

C9H14N2O2 — CID 82601347

IUPAC3-(2,3-dimethylimidazol-4-yl)-2-methylpropanoic acid
SMILESCc1ncc(CC(C)C(=O)O)n1C
InChIInChI=1S/C9H14N2O2/c1-6(9(12)13)4-8-5-10-7(2)11(8)3/h5-6H,4H2,1-3H3,(H,12,13)
InChIKeyIRTMJDIGFSOTNE-UHFFFAOYSA-N
MW182.22 g/mol
LogP0.99
Rot. Bonds3

About 3-(2,3-dimethylimidazol-4-yl)-2-methylpropanoic acid

3-(2,3-dimethylimidazol-4-yl)-2-methylpropanoic acid (PubChem CID 82601347) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 3-(2,3-dimethylimidazol-4-yl)-2-methylpropanoic acid.

Molecular Properties

Compound Name3-(2,3-dimethylimidazol-4-yl)-2-methylpropanoic acid
PubChem CID82601347
Molecular FormulaC9H14N2O2
Molecular Weight182.22 g/mol
Exact Mass182.11
IUPAC Name3-(2,3-dimethylimidazol-4-yl)-2-methylpropanoic acid
SMILESCc1ncc(CC(C)C(=O)O)n1C
InChIInChI=1S/C9H14N2O2/c1-6(9(12)13)4-8-5-10-7(2)11(8)3/h5-6H,4H2,1-3H3,(H,12,13)
InChIKeyIRTMJDIGFSOTNE-UHFFFAOYSA-N
XLogP0.99
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.22
LogP ≤ 50.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(2,3-dimethylimidazol-4-yl)-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(2,3-dimethylimidazol-4-yl)-2-hydroxyacetic acid
CID 82412586
methyl 2-(2,3-dimethylimidazol-4-yl)acetate
CID 146238760
2-amino-3-(3-methylimidazol-4-yl)propanoic acid;2-methyl-3-(3-methylimidazol-4-yl)propanoic acid
CID 158192593
3-(5-bromo-4-methyl-2-pyridinyl)-2-methylpropanoic acid
CID 83901573
2-amino-3-(2-bromo-3-methylimidazol-4-yl)propanoic acid
CID 83900196
3-(1,7-dimethylindol-2-yl)-2-methylpropanoic acid
CID 83859980
2-methyl-3-(3-methyl-5-nitroimidazol-4-yl)propanoic acid
CID 83885997
N-[(2,3-dimethylimidazol-4-yl)methyl]cyclopropanecarboxamide
CID 164659423
3-(5-methoxypyrazin-2-yl)-2-methylpropanoic acid
CID 83831149
3-(4-chloro-1-methylpyrazol-5-yl)-2-methylpropanoic acid
CID 83832130
3-(5-fluoro-1-methylindol-2-yl)-2-methylpropanoic acid
CID 83859983
3-(2,3-dimethylimidazol-4-yl)propan-1-amine
CID 82416793

Frequently Asked Questions

What is the IUPAC name of 3-(2,3-dimethylimidazol-4-yl)-2-methylpropanoic acid?
The IUPAC name of 3-(2,3-dimethylimidazol-4-yl)-2-methylpropanoic acid (CID 82601347) is 3-(2,3-dimethylimidazol-4-yl)-2-methylpropanoic acid.
What is the SMILES notation for 3-(2,3-dimethylimidazol-4-yl)-2-methylpropanoic acid?
The canonical SMILES for 3-(2,3-dimethylimidazol-4-yl)-2-methylpropanoic acid is Cc1ncc(CC(C)C(=O)O)n1C.
What is the InChIKey of 3-(2,3-dimethylimidazol-4-yl)-2-methylpropanoic acid?
The InChIKey is IRTMJDIGFSOTNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-6(9(12)13)4-8-5-10-7(2)11(8)3/h5-6H,4H2,1-3H3,(H,12,13).
What are the key properties of 3-(2,3-dimethylimidazol-4-yl)-2-methylpropanoic acid?
3-(2,3-dimethylimidazol-4-yl)-2-methylpropanoic acid has a molecular weight of 182.22 g/mol, XLogP of 0.99, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dimethylimidazol-4-yl)-2-methylpropanoic acid is sourced from PubChem (CID 82601347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).