C12H18N2O2 — CID 82617235
4-[3-(aminomethyl)piperidin-4-yl]benzene-1,2-diol (PubChem CID 82617235) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-[3-(aminomethyl)piperidin-4-yl]benzene-1,2-diol.
| Compound Name | 4-[3-(aminomethyl)piperidin-4-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 82617235 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 4-[3-(aminomethyl)piperidin-4-yl]benzene-1,2-diol |
| SMILES | NCC1CNCCC1c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H18N2O2/c13-6-9-7-14-4-3-10(9)8-1-2-11(15)12(16)5-8/h1-2,5,9-10,14-16H,3-4,6-7,13H2 |
| InChIKey | BZMBKTFYZWENSX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|