C12H11ClN6 — CID 826222
[4-chloro-6-(4-methylanilino)-1,3,5-triazin-2-yl]-methylcyanamide (PubChem CID 826222) has the molecular formula C12H11ClN6 and a molecular weight of 274.72 g/mol. Its IUPAC name is [4-chloro-6-(4-methylanilino)-1,3,5-triazin-2-yl]-methylcyanamide.
| Compound Name | [4-chloro-6-(4-methylanilino)-1,3,5-triazin-2-yl]-methylcyanamide |
|---|---|
| PubChem CID | 826222 |
| Molecular Formula | C12H11ClN6 |
| Molecular Weight | 274.72 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | [4-chloro-6-(4-methylanilino)-1,3,5-triazin-2-yl]-methylcyanamide |
| SMILES | Cc1ccc(Nc2nc(Cl)nc(N(C)C#N)n2)cc1 |
| InChI | InChI=1S/C12H11ClN6/c1-8-3-5-9(6-4-8)15-11-16-10(13)17-12(18-11)19(2)7-14/h3-6H,1-2H3,(H,15,16,17,18) |
| InChIKey | JLLCHARGIPYMIT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.72 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|