C14H18N2O2 — CID 82622821
7-(4-methoxy-1H-indol-5-yl)-1,4-oxazepane (PubChem CID 82622821) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 7-(4-methoxy-1H-indol-5-yl)-1,4-oxazepane.
| Compound Name | 7-(4-methoxy-1H-indol-5-yl)-1,4-oxazepane |
|---|---|
| PubChem CID | 82622821 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 7-(4-methoxy-1H-indol-5-yl)-1,4-oxazepane |
| SMILES | COc1c(C2CCNCCO2)ccc2[nH]ccc12 |
| InChI | InChI=1S/C14H18N2O2/c1-17-14-10-4-7-16-12(10)3-2-11(14)13-5-6-15-8-9-18-13/h2-4,7,13,15-16H,5-6,8-9H2,1H3 |
| InChIKey | PJUDGNDSBUENAI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |