C15H19NO3 — CID 82624014
1-methyl-3,4,8,9,10,11-hexahydro-2H-oxepino[2,3-h]quinoline-11-carboxylic acid (PubChem CID 82624014) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 1-methyl-3,4,8,9,10,11-hexahydro-2H-oxepino[2,3-h]quinoline-11-carboxylic acid.
| Compound Name | 1-methyl-3,4,8,9,10,11-hexahydro-2H-oxepino[2,3-h]quinoline-11-carboxylic acid |
|---|---|
| PubChem CID | 82624014 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 1-methyl-3,4,8,9,10,11-hexahydro-2H-oxepino[2,3-h]quinoline-11-carboxylic acid |
| SMILES | CN1CCCc2ccc3c(c21)C(C(=O)O)CCCO3 |
| InChI | InChI=1S/C15H19NO3/c1-16-8-2-4-10-6-7-12-13(14(10)16)11(15(17)18)5-3-9-19-12/h6-7,11H,2-5,8-9H2,1H3,(H,17,18) |
| InChIKey | DIYSVDIRUAZYFL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |