C15H18O4 — CID 82624154
2-(2-methyl-2,3,6,7,8,9-hexahydrofuro[3,2-i][1]benzoxepin-6-yl)acetic acid (PubChem CID 82624154) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is 2-(2-methyl-2,3,6,7,8,9-hexahydrofuro[3,2-i][1]benzoxepin-6-yl)acetic acid.
| Compound Name | 2-(2-methyl-2,3,6,7,8,9-hexahydrofuro[3,2-i][1]benzoxepin-6-yl)acetic acid |
|---|---|
| PubChem CID | 82624154 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-(2-methyl-2,3,6,7,8,9-hexahydrofuro[3,2-i][1]benzoxepin-6-yl)acetic acid |
| SMILES | CC1Cc2ccc3c(c2O1)OCCCC3CC(=O)O |
| InChI | InChI=1S/C15H18O4/c1-9-7-11-4-5-12-10(8-13(16)17)3-2-6-18-15(12)14(11)19-9/h4-5,9-10H,2-3,6-8H2,1H3,(H,16,17) |
| InChIKey | JTYJKTDHSARRHH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |