C14H21ClN2O — CID 82625398
8-chloro-7-methoxy-N,1,5-trimethyl-3,4-dihydro-2H-1-benzazepin-5-amine (PubChem CID 82625398) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is 8-chloro-7-methoxy-N,1,5-trimethyl-3,4-dihydro-2H-1-benzazepin-5-amine.
| Compound Name | 8-chloro-7-methoxy-N,1,5-trimethyl-3,4-dihydro-2H-1-benzazepin-5-amine |
|---|---|
| PubChem CID | 82625398 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 8-chloro-7-methoxy-N,1,5-trimethyl-3,4-dihydro-2H-1-benzazepin-5-amine |
| SMILES | CNC1(C)CCCN(C)c2cc(Cl)c(OC)cc21 |
| InChI | InChI=1S/C14H21ClN2O/c1-14(16-2)6-5-7-17(3)12-9-11(15)13(18-4)8-10(12)14/h8-9,16H,5-7H2,1-4H3 |
| InChIKey | CBYKPUWBRBGNIY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|