C12H17ClN2O2 — CID 117002959
1-(4-chloro-2,5-dimethoxyphenyl)-N-methylazetidin-3-amine (PubChem CID 117002959) has the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)-N-methylazetidin-3-amine.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)-N-methylazetidin-3-amine |
|---|---|
| PubChem CID | 117002959 |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)-N-methylazetidin-3-amine |
| SMILES | CNC1CN(c2cc(OC)c(Cl)cc2OC)C1 |
| InChI | InChI=1S/C12H17ClN2O2/c1-14-8-6-15(7-8)10-5-11(16-2)9(13)4-12(10)17-3/h4-5,8,14H,6-7H2,1-3H3 |
| InChIKey | YPLYSHVLSQVJOE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |