C11H15ClN2O — CID 117002920
1-(5-chloro-2-methoxyphenyl)-N-methylazetidin-3-amine (PubChem CID 117002920) has the molecular formula C11H15ClN2O and a molecular weight of 226.71 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-N-methylazetidin-3-amine.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-N-methylazetidin-3-amine |
|---|---|
| PubChem CID | 117002920 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-N-methylazetidin-3-amine |
| SMILES | CNC1CN(c2cc(Cl)ccc2OC)C1 |
| InChI | InChI=1S/C11H15ClN2O/c1-13-9-6-14(7-9)10-5-8(12)3-4-11(10)15-2/h3-5,9,13H,6-7H2,1-2H3 |
| InChIKey | FJPQIQGRXOZHQO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |