C14H17ClN2O — CID 82667099
3-(5-chloro-1,2-dimethylindol-3-yl)morpholine (PubChem CID 82667099) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is 3-(5-chloro-1,2-dimethylindol-3-yl)morpholine.
| Compound Name | 3-(5-chloro-1,2-dimethylindol-3-yl)morpholine |
|---|---|
| PubChem CID | 82667099 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3-(5-chloro-1,2-dimethylindol-3-yl)morpholine |
| SMILES | Cc1c(C2COCCN2)c2cc(Cl)ccc2n1C |
| InChI | InChI=1S/C14H17ClN2O/c1-9-14(12-8-18-6-5-16-12)11-7-10(15)3-4-13(11)17(9)2/h3-4,7,12,16H,5-6,8H2,1-2H3 |
| InChIKey | BFFGRZKQLJDFJH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|