C13H15N3O4 — CID 82667538
methyl 3-(2-methoxy-4,5-dimethylpyrrolo[3,2-d]pyrimidin-7-yl)-3-oxopropanoate (PubChem CID 82667538) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is methyl 3-(2-methoxy-4,5-dimethylpyrrolo[3,2-d]pyrimidin-7-yl)-3-oxopropanoate.
| Compound Name | methyl 3-(2-methoxy-4,5-dimethylpyrrolo[3,2-d]pyrimidin-7-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 82667538 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | methyl 3-(2-methoxy-4,5-dimethylpyrrolo[3,2-d]pyrimidin-7-yl)-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)c1cn(C)c2c(C)nc(OC)nc12 |
| InChI | InChI=1S/C13H15N3O4/c1-7-12-11(15-13(14-7)20-4)8(6-16(12)2)9(17)5-10(18)19-3/h6H,5H2,1-4H3 |
| InChIKey | UATBADPDTLNTPC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|