C12H17FN4O — CID 82684483
1-butyl-3-(2-carbamimidoyl-4-fluorophenyl)urea (PubChem CID 82684483) has the molecular formula C12H17FN4O and a molecular weight of 252.29 g/mol. Its IUPAC name is 1-butyl-3-(2-carbamimidoyl-4-fluorophenyl)urea.
| Compound Name | 1-butyl-3-(2-carbamimidoyl-4-fluorophenyl)urea |
|---|---|
| PubChem CID | 82684483 |
| Molecular Formula | C12H17FN4O |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 1-butyl-3-(2-carbamimidoyl-4-fluorophenyl)urea |
| SMILES | [H]/N=C(\N)c1cc(F)ccc1NC(=O)NCCCC |
| InChI | InChI=1S/C12H17FN4O/c1-2-3-6-16-12(18)17-10-5-4-8(13)7-9(10)11(14)15/h4-5,7H,2-3,6H2,1H3,(H3,14,15)(H2,16,17,18) |
| InChIKey | NSPIRWILBWJZPE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|