C10H13FN4O — CID 82685806
1-(2-carbamimidoyl-4-fluorophenyl)-3-ethylurea (PubChem CID 82685806) has the molecular formula C10H13FN4O and a molecular weight of 224.24 g/mol. Its IUPAC name is 1-(2-carbamimidoyl-4-fluorophenyl)-3-ethylurea.
| Compound Name | 1-(2-carbamimidoyl-4-fluorophenyl)-3-ethylurea |
|---|---|
| PubChem CID | 82685806 |
| Molecular Formula | C10H13FN4O |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 1-(2-carbamimidoyl-4-fluorophenyl)-3-ethylurea |
| SMILES | [H]/N=C(\N)c1cc(F)ccc1NC(=O)NCC |
| InChI | InChI=1S/C10H13FN4O/c1-2-14-10(16)15-8-4-3-6(11)5-7(8)9(12)13/h3-5H,2H2,1H3,(H3,12,13)(H2,14,15,16) |
| InChIKey | WUYLCVHKAMDBGX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|