C14H19FN4O — CID 82684682
N-(2-carbamimidoyl-4-fluorophenyl)azepane-1-carboxamide (PubChem CID 82684682) has the molecular formula C14H19FN4O and a molecular weight of 278.33 g/mol. Its IUPAC name is N-(2-carbamimidoyl-4-fluorophenyl)azepane-1-carboxamide.
| Compound Name | N-(2-carbamimidoyl-4-fluorophenyl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 82684682 |
| Molecular Formula | C14H19FN4O |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | N-(2-carbamimidoyl-4-fluorophenyl)azepane-1-carboxamide |
| SMILES | [H]/N=C(\N)c1cc(F)ccc1NC(=O)N1CCCCCC1 |
| InChI | InChI=1S/C14H19FN4O/c15-10-5-6-12(11(9-10)13(16)17)18-14(20)19-7-3-1-2-4-8-19/h5-6,9H,1-4,7-8H2,(H3,16,17)(H,18,20) |
| InChIKey | PYRGUUPCFZNSLR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|