C15H16FN3 — CID 82693497
4-[(3,5-diethylpyrazol-1-yl)methyl]-3-fluorobenzonitrile (PubChem CID 82693497) has the molecular formula C15H16FN3 and a molecular weight of 257.31 g/mol. Its IUPAC name is 4-[(3,5-diethylpyrazol-1-yl)methyl]-3-fluorobenzonitrile.
| Compound Name | 4-[(3,5-diethylpyrazol-1-yl)methyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 82693497 |
| Molecular Formula | C15H16FN3 |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 4-[(3,5-diethylpyrazol-1-yl)methyl]-3-fluorobenzonitrile |
| SMILES | CCc1cc(CC)n(Cc2ccc(C#N)cc2F)n1 |
| InChI | InChI=1S/C15H16FN3/c1-3-13-8-14(4-2)19(18-13)10-12-6-5-11(9-17)7-15(12)16/h5-8H,3-4,10H2,1-2H3 |
| InChIKey | ILYKUUTXWWHLLJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |