C10H13ClN6 — CID 82698668
4-chloro-6-(3,5-diethylpyrazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 82698668) has the molecular formula C10H13ClN6 and a molecular weight of 252.71 g/mol. Its IUPAC name is 4-chloro-6-(3,5-diethylpyrazol-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-(3,5-diethylpyrazol-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 82698668 |
| Molecular Formula | C10H13ClN6 |
| Molecular Weight | 252.71 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 4-chloro-6-(3,5-diethylpyrazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CCc1cc(CC)n(-c2nc(N)nc(Cl)n2)n1 |
| InChI | InChI=1S/C10H13ClN6/c1-3-6-5-7(4-2)17(16-6)10-14-8(11)13-9(12)15-10/h5H,3-4H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | LXAVSIQYPKBPLW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.71 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |