C11H15N3S — CID 82700131
4-[(3,5-diethylpyrazol-1-yl)methyl]-1,3-thiazole (PubChem CID 82700131) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is 4-[(3,5-diethylpyrazol-1-yl)methyl]-1,3-thiazole.
| Compound Name | 4-[(3,5-diethylpyrazol-1-yl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 82700131 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 4-[(3,5-diethylpyrazol-1-yl)methyl]-1,3-thiazole |
| SMILES | CCc1cc(CC)n(Cc2cscn2)n1 |
| InChI | InChI=1S/C11H15N3S/c1-3-9-5-11(4-2)14(13-9)6-10-7-15-8-12-10/h5,7-8H,3-4,6H2,1-2H3 |
| InChIKey | HHCGEOSRFKBHTC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |