C6H15NO3 — CID 82706992
N,1,1-trimethoxypropan-2-amine (PubChem CID 82706992) has the molecular formula C6H15NO3 and a molecular weight of 149.19 g/mol. Its IUPAC name is N,1,1-trimethoxypropan-2-amine.
| Compound Name | N,1,1-trimethoxypropan-2-amine |
|---|---|
| PubChem CID | 82706992 |
| Molecular Formula | C6H15NO3 |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.11 |
| IUPAC Name | N,1,1-trimethoxypropan-2-amine |
| SMILES | CONC(C)C(OC)OC |
| InChI | InChI=1S/C6H15NO3/c1-5(7-10-4)6(8-2)9-3/h5-7H,1-4H3 |
| InChIKey | XOFIUFKMIIFNCP-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|