C14H19F3N2O — CID 82712792
1-benzyl-N-(2,2,2-trifluoroethoxy)piperidin-3-amine (PubChem CID 82712792) has the molecular formula C14H19F3N2O and a molecular weight of 288.31 g/mol. Its IUPAC name is 1-benzyl-N-(2,2,2-trifluoroethoxy)piperidin-3-amine.
| Compound Name | 1-benzyl-N-(2,2,2-trifluoroethoxy)piperidin-3-amine |
|---|---|
| PubChem CID | 82712792 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1-benzyl-N-(2,2,2-trifluoroethoxy)piperidin-3-amine |
| SMILES | FC(F)(F)CONC1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C14H19F3N2O/c15-14(16,17)11-20-18-13-7-4-8-19(10-13)9-12-5-2-1-3-6-12/h1-3,5-6,13,18H,4,7-11H2 |
| InChIKey | MRMOCQIIGZXZJR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|