About 1-[(2,2,2-trifluoroethoxyamino)methyl]cycloheptan-1-ol
1-[(2,2,2-trifluoroethoxyamino)methyl]cycloheptan-1-ol (PubChem CID 82722622) has the molecular formula C10H18F3NO2
and a molecular weight of 241.25 g/mol. Its IUPAC name is 1-[(2,2,2-trifluoroethoxyamino)methyl]cycloheptan-1-ol.
Molecular Properties
| Compound Name | 1-[(2,2,2-trifluoroethoxyamino)methyl]cycloheptan-1-ol |
| PubChem CID | 82722622 |
| Molecular Formula | C10H18F3NO2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 1-[(2,2,2-trifluoroethoxyamino)methyl]cycloheptan-1-ol |
| SMILES | OC1(CNOCC(F)(F)F)CCCCCC1 |
| InChI | InChI=1S/C10H18F3NO2/c11-10(12,13)8-16-14-7-9(15)5-3-1-2-4-6-9/h14-15H,1-8H2 |
| InChIKey | UEBJGLNNYNOQBI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,2,2-trifluoroethoxyamino)methyl]cycloheptan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,2,2-trifluoroethoxyamino)methyl]cycloheptan-1-ol?
The IUPAC name of 1-[(2,2,2-trifluoroethoxyamino)methyl]cycloheptan-1-ol (CID 82722622) is 1-[(2,2,2-trifluoroethoxyamino)methyl]cycloheptan-1-ol.
What is the SMILES notation for 1-[(2,2,2-trifluoroethoxyamino)methyl]cycloheptan-1-ol?
The canonical SMILES for 1-[(2,2,2-trifluoroethoxyamino)methyl]cycloheptan-1-ol is OC1(CNOCC(F)(F)F)CCCCCC1.
What is the InChIKey of 1-[(2,2,2-trifluoroethoxyamino)methyl]cycloheptan-1-ol?
The InChIKey is UEBJGLNNYNOQBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3NO2/c11-10(12,13)8-16-14-7-9(15)5-3-1-2-4-6-9/h14-15H,1-8H2.
What are the key properties of 1-[(2,2,2-trifluoroethoxyamino)methyl]cycloheptan-1-ol?
1-[(2,2,2-trifluoroethoxyamino)methyl]cycloheptan-1-ol has a molecular weight of 241.25 g/mol, XLogP of 2.16, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,2,2-trifluoroethoxyamino)methyl]cycloheptan-1-ol is sourced from PubChem (CID 82722622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).