C12H17NO2 — CID 82729133
2,5-dimethyl-1-(2-methyloxolan-3-yl)pyrrole-3-carbaldehyde (PubChem CID 82729133) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2,5-dimethyl-1-(2-methyloxolan-3-yl)pyrrole-3-carbaldehyde.
| Compound Name | 2,5-dimethyl-1-(2-methyloxolan-3-yl)pyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 82729133 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2,5-dimethyl-1-(2-methyloxolan-3-yl)pyrrole-3-carbaldehyde |
| SMILES | Cc1cc(C=O)c(C)n1C1CCOC1C |
| InChI | InChI=1S/C12H17NO2/c1-8-6-11(7-14)9(2)13(8)12-4-5-15-10(12)3/h6-7,10,12H,4-5H2,1-3H3 |
| InChIKey | JLLYNIDJMGFROP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|