C11H10N2O2S — CID 82730435
2-(3-ethyl-2-pyridinyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 82730435) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 2-(3-ethyl-2-pyridinyl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(3-ethyl-2-pyridinyl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82730435 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2-(3-ethyl-2-pyridinyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | CCc1cccnc1-c1ncc(C(=O)O)s1 |
| InChI | InChI=1S/C11H10N2O2S/c1-2-7-4-3-5-12-9(7)10-13-6-8(16-10)11(14)15/h3-6H,2H2,1H3,(H,14,15) |
| InChIKey | NRTVCZTZCIHBMH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |