C12H17N5OS — CID 82744158
N-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl]-N-methyloxolan-3-amine (PubChem CID 82744158) has the molecular formula C12H17N5OS and a molecular weight of 279.37 g/mol. Its IUPAC name is N-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl]-N-methyloxolan-3-amine.
| Compound Name | N-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl]-N-methyloxolan-3-amine |
|---|---|
| PubChem CID | 82744158 |
| Molecular Formula | C12H17N5OS |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl]-N-methyloxolan-3-amine |
| SMILES | CN(Cc1nc(NN)c2ccsc2n1)C1CCOC1 |
| InChI | InChI=1S/C12H17N5OS/c1-17(8-2-4-18-7-8)6-10-14-11(16-13)9-3-5-19-12(9)15-10/h3,5,8H,2,4,6-7,13H2,1H3,(H,14,15,16) |
| InChIKey | GYHOSDPFDWGLSR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|