C16H18ClN3O — CID 82745168
(5-amino-3,4-dihydro-2H-quinolin-1-yl)-(4-chloro-1-ethylpyrrol-2-yl)methanone (PubChem CID 82745168) has the molecular formula C16H18ClN3O and a molecular weight of 303.79 g/mol. Its IUPAC name is (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(4-chloro-1-ethylpyrrol-2-yl)methanone.
| Compound Name | (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(4-chloro-1-ethylpyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 82745168 |
| Molecular Formula | C16H18ClN3O |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(4-chloro-1-ethylpyrrol-2-yl)methanone |
| SMILES | CCn1cc(Cl)cc1C(=O)N1CCCc2c(N)cccc21 |
| InChI | InChI=1S/C16H18ClN3O/c1-2-19-10-11(17)9-15(19)16(21)20-8-4-5-12-13(18)6-3-7-14(12)20/h3,6-7,9-10H,2,4-5,8,18H2,1H3 |
| InChIKey | AKKVFVMUKKPUSY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|