C17H22FNO — CID 82749677
1-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-3-(2-fluorophenyl)propan-2-one (PubChem CID 82749677) has the molecular formula C17H22FNO and a molecular weight of 275.37 g/mol. Its IUPAC name is 1-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-3-(2-fluorophenyl)propan-2-one.
| Compound Name | 1-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-3-(2-fluorophenyl)propan-2-one |
|---|---|
| PubChem CID | 82749677 |
| Molecular Formula | C17H22FNO |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 1-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-3-(2-fluorophenyl)propan-2-one |
| SMILES | O=C(Cc1ccccc1F)CN1CCC2CCCCC21 |
| InChI | InChI=1S/C17H22FNO/c18-16-7-3-1-6-14(16)11-15(20)12-19-10-9-13-5-2-4-8-17(13)19/h1,3,6-7,13,17H,2,4-5,8-12H2 |
| InChIKey | KILFREHQIPIXJY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |